CAS 354124-90-6 appears in our catalog under these names: [2-(4-Fluoro-phenylamino)-thiazol-4-yl]-acetic acid, 95%, 2-(2-((4-Fluorophenyl)amino)thiazol-4-yl)acetic acid, 97%, 2-(4-(4-Fluorophenylamino)-3,5-thiazolyl)acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 10g, 5g, 1g, 10000mg, 5000mg.
2-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]acetic acid (CAS 354124-90-6) is a chemical compound with the molecular formula C11H9FN2O2S and a molecular weight of 252.27 g/mol. IUPAC name: 2-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]acetic acid. InChIKey: DKMOQDZYPOFTDL-UHFFFAOYSA-N.
| Molecular formula | C11H9FN2O2S |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | 2-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]acetic acid |
| InChIKey | DKMOQDZYPOFTDL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC2=NC(=CS2)CC(=O)O)F |
Computed by PubChem (NCBI)