Products 943110-83-6

CAS 943110-83-6 is the registry number for 2-((2-Fluorophenyl)amino)-4-methyl-1,3-thiazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.

Structural formula: {0} (CAS {1})

2-(2-fluoroanilino)-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 943110-83-6) is a chemical compound with the molecular formula C11H9FN2O2S and a molecular weight of 252.27 g/mol. IUPAC name: 2-(2-fluoroanilino)-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: PVUNYLMBUNYZDC-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9FN2O2S
Molecular weight252.27 g/mol
IUPAC name2-(2-fluoroanilino)-4-methyl-1,3-thiazole-5-carboxylic acid
InChIKeyPVUNYLMBUNYZDC-UHFFFAOYSA-N
SMILESCC1=C(SC(=N1)NC2=CC=CC=C2F)C(=O)O

Computed by PubChem (NCBI)