CAS 943110-83-6 is the registry number for 2-((2-Fluorophenyl)amino)-4-methyl-1,3-thiazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
2-(2-fluoroanilino)-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 943110-83-6) is a chemical compound with the molecular formula C11H9FN2O2S and a molecular weight of 252.27 g/mol. IUPAC name: 2-(2-fluoroanilino)-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: PVUNYLMBUNYZDC-UHFFFAOYSA-N.
| Molecular formula | C11H9FN2O2S |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | 2-(2-fluoroanilino)-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | PVUNYLMBUNYZDC-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)NC2=CC=CC=C2F)C(=O)O |
Computed by PubChem (NCBI)