CAS 776-79-4 appears in our catalog under these names: 2-(2-Carboxyethyl)benzoic acid 98%, 3-(2-CARBOXYPHENYL)PROPIONIC ACID, 99%, 2-(2-Carboxyethyl)benzoic acid, 98%, 98%, 3-(2-Carboxyphenyl)propionic acid, 95%. Offered by: Ambeed, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
2-(2-carboxyethyl)benzoic acid (CAS 776-79-4) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 2-(2-carboxyethyl)benzoic acid. InChIKey: VEEXBQLWMFMATJ-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 2-(2-carboxyethyl)benzoic acid |
| InChIKey | VEEXBQLWMFMATJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)