CAS 778-40-5 is the registry number for 2-Methyl-1-(2,3,5,6-tetramethylphenyl)propan-1-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-1-(2,3,5,6-tetramethylphenyl)propan-1-one (CAS 778-40-5) is a chemical compound with the molecular formula C14H20O and a molecular weight of 204.31 g/mol. IUPAC name: 2-methyl-1-(2,3,5,6-tetramethylphenyl)propan-1-one. InChIKey: YKRDIDRSBAFSHF-UHFFFAOYSA-N.
| Molecular formula | C14H20O |
|---|---|
| Molecular weight | 204.31 g/mol |
| IUPAC name | 2-methyl-1-(2,3,5,6-tetramethylphenyl)propan-1-one |
| InChIKey | YKRDIDRSBAFSHF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C)C(=O)C(C)C)C)C |
Computed by PubChem (NCBI)