CAS 77841-56-6 is the registry number for rac-(1R,2S,3R,5R)-3-Amino-5-(hydroxymethyl)cyclopentane-1,2-diol hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1S,2R,3S,5S)-3-amino-5-(hydroxymethyl)cyclopentane-1,2-diol;hydrochloride (CAS 77841-56-6) is a chemical compound with the molecular formula C6H14ClNO3 and a molecular weight of 183.63 g/mol. IUPAC name: (1S,2R,3S,5S)-3-amino-5-(hydroxymethyl)cyclopentane-1,2-diol;hydrochloride. InChIKey: BLTXEPQZAMUGID-VKYWDCQCSA-N.
| Molecular formula | C6H14ClNO3 |
|---|---|
| Molecular weight | 183.63 g/mol |
| IUPAC name | (1S,2R,3S,5S)-3-amino-5-(hydroxymethyl)cyclopentane-1,2-diol;hydrochloride |
| InChIKey | BLTXEPQZAMUGID-VKYWDCQCSA-N |
| SMILES | C1[C@H]([C@@H]([C@@H]([C@H]1N)O)O)CO.Cl |
Computed by PubChem (NCBI)