CAS 77923-97-8 is the registry number for N,N-Diisopropylpicolinamide 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
N,N-di(propan-2-yl)pyridine-2-carboxamide (CAS 77923-97-8) is a chemical compound with the molecular formula C12H18N2O and a molecular weight of 206.28 g/mol. IUPAC name: N,N-di(propan-2-yl)pyridine-2-carboxamide. InChIKey: RISFVVVLZGXXCV-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | N,N-di(propan-2-yl)pyridine-2-carboxamide |
| InChIKey | RISFVVVLZGXXCV-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(C)C)C(=O)C1=CC=CC=N1 |
Computed by PubChem (NCBI)