CAS 779331-47-4 appears in our catalog under these names: 2–Benzyloxy–5–fluorophenylboronic Acid (contains varying amounts of Anhydride), 2-Benzyloxy-5-fluorophenylboronic Acid (contains varying amounts of Anhydride), (2-(Benzyloxy)-5-fluorophenyl)boronic acid 98%, 2-Benzyloxy-5-fluorophenylboronic acid, 98%, 98%, 2-Benzyloxy-5-fluorophenylboronic acid, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 25g, 250mg, 100g.
(5-fluoro-2-phenylmethoxyphenyl)boronic acid (CAS 779331-47-4) is a chemical compound with the molecular formula C13H12BFO3 and a molecular weight of 246.04 g/mol. IUPAC name: (5-fluoro-2-phenylmethoxyphenyl)boronic acid. InChIKey: ULIJNMCAPASXHA-UHFFFAOYSA-N.
| Molecular formula | C13H12BFO3 |
|---|---|
| Molecular weight | 246.04 g/mol |
| IUPAC name | (5-fluoro-2-phenylmethoxyphenyl)boronic acid |
| InChIKey | ULIJNMCAPASXHA-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)F)OCC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)