CAS 77995-55-2 appears in our catalog under these names: 4-Hydrazino-2,5,6-trimethylthieno[2,3-d]pyrimidine, 95%, 4-Hydrazino-2,5,6-trimethylthieno(2,3-d)pyrimidine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 2,5g.
(2,5,6-trimethylthieno[2,3-d]pyrimidin-4-yl)hydrazine (CAS 77995-55-2) is a chemical compound with the molecular formula C9H12N4S and a molecular weight of 208.29 g/mol. IUPAC name: (2,5,6-trimethylthieno[2,3-d]pyrimidin-4-yl)hydrazine. InChIKey: CMPBIWVMOPSFSD-UHFFFAOYSA-N.
| Molecular formula | C9H12N4S |
|---|---|
| Molecular weight | 208.29 g/mol |
| IUPAC name | (2,5,6-trimethylthieno[2,3-d]pyrimidin-4-yl)hydrazine |
| InChIKey | CMPBIWVMOPSFSD-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=NC(=NC(=C12)NN)C)C |
Computed by PubChem (NCBI)