CAS 956364-01-5 is the registry number for 4-(1-Ethyl-5-methyl-1H-pyrazol-4-yl)-1,3-thiazol-2-amine. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
4-(1-ethyl-5-methylpyrazol-4-yl)-1,3-thiazol-2-amine (CAS 956364-01-5) is a chemical compound with the molecular formula C9H12N4S and a molecular weight of 208.29 g/mol. IUPAC name: 4-(1-ethyl-5-methylpyrazol-4-yl)-1,3-thiazol-2-amine. InChIKey: LHBGSPNAUKTQJY-UHFFFAOYSA-N.
| Molecular formula | C9H12N4S |
|---|---|
| Molecular weight | 208.29 g/mol |
| IUPAC name | 4-(1-ethyl-5-methylpyrazol-4-yl)-1,3-thiazol-2-amine |
| InChIKey | LHBGSPNAUKTQJY-UHFFFAOYSA-N |
| SMILES | CCN1C(=C(C=N1)C2=CSC(=N2)N)C |
Computed by PubChem (NCBI)