CAS 957301-85-8 appears in our catalog under these names: 4-(1-Ethyl-3-methyl-1H-pyrazol-4-yl)-1,3-thiazol-2-amine, 4-(1-Ethyl-3-methyl-1 H -pyrazol-4-yl)-thiazol-2-ylamine. Offered by: Biosynth, Fluorochem. Available pack sizes: 1g, 100mg.
4-(1-ethyl-3-methylpyrazol-4-yl)-1,3-thiazol-2-amine (CAS 957301-85-8) is a chemical compound with the molecular formula C9H12N4S and a molecular weight of 208.29 g/mol. IUPAC name: 4-(1-ethyl-3-methylpyrazol-4-yl)-1,3-thiazol-2-amine. InChIKey: XTCYXUNFSOUYPJ-UHFFFAOYSA-N.
| Molecular formula | C9H12N4S |
|---|---|
| Molecular weight | 208.29 g/mol |
| IUPAC name | 4-(1-ethyl-3-methylpyrazol-4-yl)-1,3-thiazol-2-amine |
| InChIKey | XTCYXUNFSOUYPJ-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C(=N1)C)C2=CSC(=N2)N |
Computed by PubChem (NCBI)