Products 78010-42-1

CAS 78010-42-1 is the registry number for 3-Diamantanecarboxylic Acid. Offered by: TRC. Available pack sizes: 50mg, 5mg.

Structural formula: {0} (CAS {1})

Pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-3-carboxylic acid (CAS 78010-42-1) is a chemical compound with the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. IUPAC name: pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-3-carboxylic acid. InChIKey: ITYGSFVLZZPKCH-UHFFFAOYSA-N.

Identity
Molecular formulaC15H20O2
Molecular weight232.32 g/mol
IUPAC namepentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-3-carboxylic acid
InChIKeyITYGSFVLZZPKCH-UHFFFAOYSA-N
SMILESC1C2CC3C4C1C5CC(C4)C(C3C5C2)C(=O)O

Computed by PubChem (NCBI)