CAS 782-92-3 appears in our catalog under these names: (4-Acetylphenyl)phenylmethane, 95%, 1-(4-Benzylphenyl)ethanone. Offered by: Combi-blocks, TRC. Available pack sizes: 1g, 2,5g, 250mg.
1-(4-benzylphenyl)ethanone (CAS 782-92-3) is a chemical compound with the molecular formula C15H14O and a molecular weight of 210.27 g/mol. IUPAC name: 1-(4-benzylphenyl)ethanone. InChIKey: PPYJQGBEZQOXHC-UHFFFAOYSA-N.
| Molecular formula | C15H14O |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | 1-(4-benzylphenyl)ethanone |
| InChIKey | PPYJQGBEZQOXHC-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)