Products 783-04-0
CAS 783-04-0 is the registry number for 1-((E)-2-nitroprop-1-enyl)-3-(trifluoromethyl)benzene. Offered by: Biosynth. Available pack sizes: 100mg, 250mg, 500mg.
1-[(E)-2-nitroprop-1-enyl]-3-(trifluoromethyl)benzene (CAS 783-04-0) is a chemical compound with the molecular formula C10H8F3NO2 and a molecular weight of 231.17 g/mol. IUPAC name: 1-[(E)-2-nitroprop-1-enyl]-3-(trifluoromethyl)benzene. InChIKey: KDMSDFWVSIRTOL-FNORWQNLSA-N.
| Molecular formula | C10H8F3NO2 |
|---|---|
| Molecular weight | 231.17 g/mol |
| IUPAC name | 1-[(E)-2-nitroprop-1-enyl]-3-(trifluoromethyl)benzene |
| InChIKey | KDMSDFWVSIRTOL-FNORWQNLSA-N |
| SMILES | C/C(=C\C1=CC(=CC=C1)C(F)(F)F)/[N+](=O)[O-] |
Computed by PubChem (NCBI)