CAS 783349-41-7 is the registry number for (3R)-2,2-Dimethyl-5-oxooxolane-3-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g, 100mg, 5g, 250mg.
(3R)-2,2-dimethyl-5-oxooxolane-3-carboxylic acid (CAS 783349-41-7) is a chemical compound with the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. IUPAC name: (3R)-2,2-dimethyl-5-oxooxolane-3-carboxylic acid. InChIKey: UZBOWOQARWWIER-BYPYZUCNSA-N.
| Molecular formula | C7H10O4 |
|---|---|
| Molecular weight | 158.15 g/mol |
| IUPAC name | (3R)-2,2-dimethyl-5-oxooxolane-3-carboxylic acid |
| InChIKey | UZBOWOQARWWIER-BYPYZUCNSA-N |
| SMILES | CC1([C@@H](CC(=O)O1)C(=O)O)C |
Computed by PubChem (NCBI)