Products 79-91-4

CAS 79-91-4 appears in our catalog under these names: Terebic acid, 98%, Terebic Acid, Terebic Acid, Terebic Acid, >98.0%(T), 2,2-Dimethyl-5-oxotetrahydrofuran-3-carboxylic acid 97%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 5g, 1g, 10000mg, 5000mg, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2,2-dimethyl-5-oxooxolane-3-carboxylic acid (CAS 79-91-4) is a chemical compound with the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. IUPAC name: 2,2-dimethyl-5-oxooxolane-3-carboxylic acid. InChIKey: UZBOWOQARWWIER-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10O4
Molecular weight158.15 g/mol
IUPAC name2,2-dimethyl-5-oxooxolane-3-carboxylic acid
InChIKeyUZBOWOQARWWIER-UHFFFAOYSA-N
SMILESCC1(C(CC(=O)O1)C(=O)O)C

Computed by PubChem (NCBI)