CAS 784-41-8 is the registry number for 2-Amino-5-chloro-4'-hydroxybenzophenone. Offered by: TRC. Available pack sizes: 100mg, 250mg, 25mg.
(2-amino-5-chlorophenyl)-(4-hydroxyphenyl)methanone (CAS 784-41-8) is a chemical compound with the molecular formula C13H10ClNO2 and a molecular weight of 247.67 g/mol. IUPAC name: (2-amino-5-chlorophenyl)-(4-hydroxyphenyl)methanone. InChIKey: AEOLBXUKBVWECZ-UHFFFAOYSA-N.
| Molecular formula | C13H10ClNO2 |
|---|---|
| Molecular weight | 247.67 g/mol |
| IUPAC name | (2-amino-5-chlorophenyl)-(4-hydroxyphenyl)methanone |
| InChIKey | AEOLBXUKBVWECZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=C(C=CC(=C2)Cl)N)O |
Computed by PubChem (NCBI)