CAS 78546-99-3 appears in our catalog under these names: 5-(2,4-Dimethoxyphenyl)cyclohexane-1,3-dione, 98%, 5-(2,4-Dimethoxyphenyl)cyclohexane-1,3-dione. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 500mg, 1000mg, 2000mg, 5000mg.
5-(2,4-dimethoxyphenyl)cyclohexane-1,3-dione (CAS 78546-99-3) is a chemical compound with the molecular formula C14H16O4 and a molecular weight of 248.27 g/mol. IUPAC name: 5-(2,4-dimethoxyphenyl)cyclohexane-1,3-dione. InChIKey: WKGWEOJDFAPKEP-UHFFFAOYSA-N.
| Molecular formula | C14H16O4 |
|---|---|
| Molecular weight | 248.27 g/mol |
| IUPAC name | 5-(2,4-dimethoxyphenyl)cyclohexane-1,3-dione |
| InChIKey | WKGWEOJDFAPKEP-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C2CC(=O)CC(=O)C2)OC |
Computed by PubChem (NCBI)