CAS 785849-99-2 is the registry number for 4-(2-(1,3-Dioxoisoindolin-2-yl)ethyl)phenyl pivalate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[4-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenyl] 2,2-dimethylpropanoate (CAS 785849-99-2) is a chemical compound with the molecular formula C21H21NO4 and a molecular weight of 351.4 g/mol. IUPAC name: [4-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenyl] 2,2-dimethylpropanoate. InChIKey: MMOSVQPYXLLQIF-UHFFFAOYSA-N.
| Molecular formula | C21H21NO4 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | [4-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenyl] 2,2-dimethylpropanoate |
| InChIKey | MMOSVQPYXLLQIF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)OC1=CC=C(C=C1)CCN2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)