CAS 786637-72-7 appears in our catalog under these names: (R)-3-Amino-3-(2-naphthyl)-propionic acid, 95%, H-β-2-Nal-OH 95%, (R)-3-Amino-3-(2-naphthyl)-propionic acid, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg.
(3R)-3-amino-3-naphthalen-2-ylpropanoic acid (CAS 786637-72-7) is a chemical compound with the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. IUPAC name: (3R)-3-amino-3-naphthalen-2-ylpropanoic acid. InChIKey: JASNXOXPNZWQRV-GFCCVEGCSA-N.
| Molecular formula | C13H13NO2 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | (3R)-3-amino-3-naphthalen-2-ylpropanoic acid |
| InChIKey | JASNXOXPNZWQRV-GFCCVEGCSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)[C@@H](CC(=O)O)N |
Computed by PubChem (NCBI)