Products 787624-25-3
CAS 787624-25-3 is the registry number for Ethyl 4-bromobenzoate-d4. Offered by: MedChemExpress. Available pack sizes: 1 mg.
Ethyl 4-bromo-2,3,5,6-tetradeuteriobenzoate (CAS 787624-25-3) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 233.09 g/mol. IUPAC name: ethyl 4-bromo-2,3,5,6-tetradeuteriobenzoate. InChIKey: XZIAFENWXIQIKR-LNFUJOGGSA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 233.09 g/mol |
| IUPAC name | ethyl 4-bromo-2,3,5,6-tetradeuteriobenzoate |
| InChIKey | XZIAFENWXIQIKR-LNFUJOGGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=O)OCC)[2H])[2H])Br)[2H] |
Computed by PubChem (NCBI)