CAS 78892-51-0 is the registry number for Isodetomidine. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 100mg.
5-[(3,4-dimethylphenyl)methyl]-1H-imidazole (CAS 78892-51-0) is a chemical compound with the molecular formula C12H14N2 and a molecular weight of 186.25 g/mol. IUPAC name: 5-[(3,4-dimethylphenyl)methyl]-1H-imidazole. InChIKey: OTTHWAKRQDLKPF-UHFFFAOYSA-N.
| Molecular formula | C12H14N2 |
|---|---|
| Molecular weight | 186.25 g/mol |
| IUPAC name | 5-[(3,4-dimethylphenyl)methyl]-1H-imidazole |
| InChIKey | OTTHWAKRQDLKPF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)CC2=CN=CN2)C |
Computed by PubChem (NCBI)