CAS 79-89-0 appears in our catalog under these names: Isomethyl-beta-ionone, Isomethyl-β-ionone. Offered by: TRC, Biosynth. Available pack sizes: 100mg.
3-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one (CAS 79-89-0) is a chemical compound with the molecular formula C14H22O and a molecular weight of 206.32 g/mol. IUPAC name: 3-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one. InChIKey: NSSHGPBKKVJJMM-UHFFFAOYSA-N.
| Molecular formula | C14H22O |
|---|---|
| Molecular weight | 206.32 g/mol |
| IUPAC name | 3-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one |
| InChIKey | NSSHGPBKKVJJMM-UHFFFAOYSA-N |
| SMILES | CC1=C(C(CCC1)(C)C)C=C(C)C(=O)C |
Computed by PubChem (NCBI)