Products 79004-02-7

CAS 79004-02-7 is the registry number for 2,3,4-Trimethoxy-6-methylbenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2,3,4-trimethoxy-6-methylbenzoic acid (CAS 79004-02-7) is a chemical compound with the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. IUPAC name: 2,3,4-trimethoxy-6-methylbenzoic acid. InChIKey: IINQNMKCOMHAMZ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14O5
Molecular weight226.23 g/mol
IUPAC name2,3,4-trimethoxy-6-methylbenzoic acid
InChIKeyIINQNMKCOMHAMZ-UHFFFAOYSA-N
SMILESCC1=CC(=C(C(=C1C(=O)O)OC)OC)OC

Computed by PubChem (NCBI)