Products 79120-58-4
CAS 79120-58-4 is the registry number for (+)-Zuonin A. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[(2R,3R,4S,5R)-5-(1,3-benzodioxol-5-yl)-3,4-dimethyloxolan-2-yl]-1,3-benzodioxole (CAS 79120-58-4) is a chemical compound with the molecular formula C20H20O5 and a molecular weight of 340.4 g/mol. IUPAC name: 5-[(2R,3R,4S,5R)-5-(1,3-benzodioxol-5-yl)-3,4-dimethyloxolan-2-yl]-1,3-benzodioxole. InChIKey: QFUXQRHAJWXPGP-BINDOVRGSA-N.
| Molecular formula | C20H20O5 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 5-[(2R,3R,4S,5R)-5-(1,3-benzodioxol-5-yl)-3,4-dimethyloxolan-2-yl]-1,3-benzodioxole |
| InChIKey | QFUXQRHAJWXPGP-BINDOVRGSA-N |
| SMILES | C[C@@H]1[C@@H]([C@@H](O[C@H]1C2=CC3=C(C=C2)OCO3)C4=CC5=C(C=C4)OCO5)C |
Computed by PubChem (NCBI)