CAS 79232-87-4 is the registry number for 6-Chloro-N-(m-tolyl)pyridazin-3-amine, 98%, 98%. Offered by: Chemat. Available pack sizes: 1g.
6-chloro-N-(3-methylphenyl)pyridazin-3-amine (CAS 79232-87-4) is a chemical compound with the molecular formula C11H10ClN3 and a molecular weight of 219.67 g/mol. IUPAC name: 6-chloro-N-(3-methylphenyl)pyridazin-3-amine. InChIKey: FJMNGYNPNWQRPY-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN3 |
|---|---|
| Molecular weight | 219.67 g/mol |
| IUPAC name | 6-chloro-N-(3-methylphenyl)pyridazin-3-amine |
| InChIKey | FJMNGYNPNWQRPY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)NC2=NN=C(C=C2)Cl |
Computed by PubChem (NCBI)