Products 79247-74-8
CAS 79247-74-8 appears in our catalog under these names: 4-(tert-Butyl)thiazole-2-carboxylic acid, 95%, 4–(tert–Butyl)thiazole–2–carboxylic acid, 4-tert-Butyl-1,3-thiazole-2-carboxylic acid. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 0,5g, 50mg.
4-tert-butyl-1,3-thiazole-2-carboxylic acid (CAS 79247-74-8) is a chemical compound with the molecular formula C8H11NO2S and a molecular weight of 185.25 g/mol. IUPAC name: 4-tert-butyl-1,3-thiazole-2-carboxylic acid. InChIKey: CLYPCQOVDDPODX-UHFFFAOYSA-N.
| Molecular formula | C8H11NO2S |
|---|---|
| Molecular weight | 185.25 g/mol |
| IUPAC name | 4-tert-butyl-1,3-thiazole-2-carboxylic acid |
| InChIKey | CLYPCQOVDDPODX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CSC(=N1)C(=O)O |
Computed by PubChem (NCBI)