CAS 79295-18-4 appears in our catalog under these names: 2-(4-chlorophenoxy)-n'-hydroxyethanimidamide, 95%, (Z)-2-(4-Chlorophenoxy)-N'-hydroxyethenimidamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
2-(4-chlorophenoxy)-N'-hydroxyethanimidamide (CAS 79295-18-4) is a chemical compound with the molecular formula C8H9ClN2O2 and a molecular weight of 200.62 g/mol. IUPAC name: 2-(4-chlorophenoxy)-N'-hydroxyethanimidamide. InChIKey: VEFDYICPJUXKSJ-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O2 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | 2-(4-chlorophenoxy)-N'-hydroxyethanimidamide |
| InChIKey | VEFDYICPJUXKSJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC/C(=N/O)/N)Cl |
Computed by PubChem (NCBI)