CAS 79359-57-2 is the registry number for 5-Hydroxy-2,2-dimethylchromane-6-carbaldehyde, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-hydroxy-2,2-dimethyl-3,4-dihydrochromene-6-carbaldehyde (CAS 79359-57-2) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: 5-hydroxy-2,2-dimethyl-3,4-dihydrochromene-6-carbaldehyde. InChIKey: ONGHNVXVGVLKCR-UHFFFAOYSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 5-hydroxy-2,2-dimethyl-3,4-dihydrochromene-6-carbaldehyde |
| InChIKey | ONGHNVXVGVLKCR-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C(O1)C=CC(=C2O)C=O)C |
Computed by PubChem (NCBI)