Products 79458-62-1
CAS 79458-62-1 is the registry number for 2-(2-Hydroxy-5-methoxyphenoxy)-acrylic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(2-hydroxy-5-methoxyphenoxy)prop-2-enoic acid (CAS 79458-62-1) is a chemical compound with the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. IUPAC name: 2-(2-hydroxy-5-methoxyphenoxy)prop-2-enoic acid. InChIKey: ZYDSNEAHMPKNPG-UHFFFAOYSA-N.
| Molecular formula | C10H10O5 |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | 2-(2-hydroxy-5-methoxyphenoxy)prop-2-enoic acid |
| InChIKey | ZYDSNEAHMPKNPG-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)O)OC(=C)C(=O)O |
Computed by PubChem (NCBI)