CAS 79491-05-7 appears in our catalog under these names: 4-(p-Tolyl)-1,2,4-triazolidine-3,5-dione, 98%, 98%, 1,2,4-Triazolidine-3,5-dione, 4-(4-methylphenyl)-, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-(4-methylphenyl)-1,2,4-triazolidine-3,5-dione (CAS 79491-05-7) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: 4-(4-methylphenyl)-1,2,4-triazolidine-3,5-dione. InChIKey: HHMLQRYQRQDWTA-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | 4-(4-methylphenyl)-1,2,4-triazolidine-3,5-dione |
| InChIKey | HHMLQRYQRQDWTA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(=O)NNC2=O |
Computed by PubChem (NCBI)