Products 79491-71-7
CAS 79491-71-7 is the registry number for Euptox A. Offered by: MedChemExpress. Available pack sizes: Get quote.
(4aS,8S,8aR)-3,8-dimethyl-5-propan-2-ylidene-4a,7,8,8a-tetrahydro-1H-naphthalene-2,6-dione (CAS 79491-71-7) is a chemical compound with the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. IUPAC name: (4aS,8S,8aR)-3,8-dimethyl-5-propan-2-ylidene-4a,7,8,8a-tetrahydro-1H-naphthalene-2,6-dione. InChIKey: RDQAKTSDUZUBQC-MVWJERBFSA-N.
| Molecular formula | C15H20O2 |
|---|---|
| Molecular weight | 232.32 g/mol |
| IUPAC name | (4aS,8S,8aR)-3,8-dimethyl-5-propan-2-ylidene-4a,7,8,8a-tetrahydro-1H-naphthalene-2,6-dione |
| InChIKey | RDQAKTSDUZUBQC-MVWJERBFSA-N |
| SMILES | C[C@H]1CC(=O)C(=C(C)C)[C@H]2[C@@H]1CC(=O)C(=C2)C |
Computed by PubChem (NCBI)
Synonyms:
Euptox A, 9-Oxo-10,11-dehydroageraphorone