Products 79584-03-5
CAS 79584-03-5 appears in our catalog under these names: 4-(Azidomethyl)benzoic acid, 95%, 4-(Azidomethyl)benzoic acid, 4-(Azidomethyl)benzoic acid 95%, 4-(azidomethyl)benzoic acid, 97%. Offered by: Combi-blocks, Iris Biotech, Ambeed, MedChemExpress, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 25g, 500mg, 25 mg, 50 mg.
4-(azidomethyl)benzoic acid (CAS 79584-03-5) is a chemical compound with the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. IUPAC name: 4-(azidomethyl)benzoic acid. InChIKey: QWRURNUFBGDSDL-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 4-(azidomethyl)benzoic acid |
| InChIKey | QWRURNUFBGDSDL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN=[N+]=[N-])C(=O)O |
Computed by PubChem (NCBI)