Products 796070-75-2
CAS 796070-75-2 appears in our catalog under these names: 2-Methyl-5-(5-methyl-1,3,4-oxadiazol-2-yl)aniline, 95%, 2-Methyl-5-(5-methyl-1,3,4-oxadiazol-2-yl)aniline, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-methyl-5-(5-methyl-1,3,4-oxadiazol-2-yl)aniline (CAS 796070-75-2) is a chemical compound with the molecular formula C10H11N3O and a molecular weight of 189.21 g/mol. IUPAC name: 2-methyl-5-(5-methyl-1,3,4-oxadiazol-2-yl)aniline. InChIKey: RKJBPLCETAIKJG-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 2-methyl-5-(5-methyl-1,3,4-oxadiazol-2-yl)aniline |
| InChIKey | RKJBPLCETAIKJG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=NN=C(O2)C)N |
Computed by PubChem (NCBI)