Products 902137-22-8
CAS 902137-22-8 appears in our catalog under these names: 5-(2,4-Dimethylphenyl)-1,3,4-oxadiazol-2-amine, 98%, 5-(2,4-Dimethylphenyl)-1,3,4-oxadiazol-2-amine, 95+%, 5-(2,4-Dimethylphenyl)-1,3,4-oxadiazol-2-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 1g, 5g, 250mg.
5-(2,4-dimethylphenyl)-1,3,4-oxadiazol-2-amine (CAS 902137-22-8) is a chemical compound with the molecular formula C10H11N3O and a molecular weight of 189.21 g/mol. IUPAC name: 5-(2,4-dimethylphenyl)-1,3,4-oxadiazol-2-amine. InChIKey: WMTJZHAGZHSWNQ-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 5-(2,4-dimethylphenyl)-1,3,4-oxadiazol-2-amine |
| InChIKey | WMTJZHAGZHSWNQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2=NN=C(O2)N)C |
Computed by PubChem (NCBI)