CAS 1597528-05-6 is the registry number for N'-Hydroxy-1-methyl-1h-indole-4-carboximidamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
N'-hydroxy-1-methylindole-4-carboximidamide (CAS 1597528-05-6) is a chemical compound with the molecular formula C10H11N3O and a molecular weight of 189.21 g/mol. IUPAC name: N'-hydroxy-1-methylindole-4-carboximidamide. InChIKey: BCJXDZGIFOIGOL-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | N'-hydroxy-1-methylindole-4-carboximidamide |
| InChIKey | BCJXDZGIFOIGOL-UHFFFAOYSA-N |
| SMILES | CN1C=CC2=C(C=CC=C21)/C(=N/O)/N |
Computed by PubChem (NCBI)