CAS 876715-43-4 appears in our catalog under these names: (3-Benzyl-1,2,4-oxadiazol-5-yl)methanamine, 97%, (3-Benzyl-1,2,4-oxadiazol-5-yl)methanamine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 10g, 1g.
(3-benzyl-1,2,4-oxadiazol-5-yl)methanamine (CAS 876715-43-4) is a chemical compound with the molecular formula C10H11N3O and a molecular weight of 189.21 g/mol. IUPAC name: (3-benzyl-1,2,4-oxadiazol-5-yl)methanamine. InChIKey: GQASRVLTKCPNCP-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | (3-benzyl-1,2,4-oxadiazol-5-yl)methanamine |
| InChIKey | GQASRVLTKCPNCP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NOC(=N2)CN |
Computed by PubChem (NCBI)