CAS 796073-61-5 is the registry number for (R)-Butane-1,3-diyl bis(4-methylbenzenesulfonate), 95%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
[(3R)-3-(4-methylphenyl)sulfonyloxybutyl] 4-methylbenzenesulfonate (CAS 796073-61-5) is a chemical compound with the molecular formula C18H22O6S2 and a molecular weight of 398.5 g/mol. IUPAC name: [(3R)-3-(4-methylphenyl)sulfonyloxybutyl] 4-methylbenzenesulfonate. InChIKey: YSOXTCSGMGOBKU-MRXNPFEDSA-N.
| Molecular formula | C18H22O6S2 |
|---|---|
| Molecular weight | 398.5 g/mol |
| IUPAC name | [(3R)-3-(4-methylphenyl)sulfonyloxybutyl] 4-methylbenzenesulfonate |
| InChIKey | YSOXTCSGMGOBKU-MRXNPFEDSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC[C@@H](C)OS(=O)(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)