Products 24330-53-8

CAS 24330-53-8 is the registry number for 1,3-Ditosyloxy-2-methylpropane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

[2-methyl-3-(4-methylphenyl)sulfonyloxypropyl] 4-methylbenzenesulfonate (CAS 24330-53-8) is a chemical compound with the molecular formula C18H22O6S2 and a molecular weight of 398.5 g/mol. IUPAC name: [2-methyl-3-(4-methylphenyl)sulfonyloxypropyl] 4-methylbenzenesulfonate. InChIKey: VWKZGNXKWAWZGN-UHFFFAOYSA-N.

Identity
Molecular formulaC18H22O6S2
Molecular weight398.5 g/mol
IUPAC name[2-methyl-3-(4-methylphenyl)sulfonyloxypropyl] 4-methylbenzenesulfonate
InChIKeyVWKZGNXKWAWZGN-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)OCC(C)COS(=O)(=O)C2=CC=C(C=C2)C

Computed by PubChem (NCBI)