CAS 894773-86-5 is the registry number for 5-Methyl-2-((methylsulfonyl)oxy)-gamma-phenylbenzenepropanol 1-Methanesulfonate. Offered by: TRC. Available pack sizes: 1g.
[3-(5-methyl-2-methylsulfonyloxyphenyl)-3-phenylpropyl] methanesulfonate (CAS 894773-86-5) is a chemical compound with the molecular formula C18H22O6S2 and a molecular weight of 398.5 g/mol. IUPAC name: [3-(5-methyl-2-methylsulfonyloxyphenyl)-3-phenylpropyl] methanesulfonate. InChIKey: PLWNVVFBYMNKJD-UHFFFAOYSA-N.
| Molecular formula | C18H22O6S2 |
|---|---|
| Molecular weight | 398.5 g/mol |
| IUPAC name | [3-(5-methyl-2-methylsulfonyloxyphenyl)-3-phenylpropyl] methanesulfonate |
| InChIKey | PLWNVVFBYMNKJD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OS(=O)(=O)C)C(CCOS(=O)(=O)C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)