CAS 4724-56-5 is the registry number for Butane-1,4-diyl bis(4-methylbenzenesulfonate), 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(4-methylphenyl)sulfonyloxybutyl 4-methylbenzenesulfonate (CAS 4724-56-5) is a chemical compound with the molecular formula C18H22O6S2 and a molecular weight of 398.5 g/mol. IUPAC name: 4-(4-methylphenyl)sulfonyloxybutyl 4-methylbenzenesulfonate. InChIKey: FSQYJJHVABILHQ-UHFFFAOYSA-N.
| Molecular formula | C18H22O6S2 |
|---|---|
| Molecular weight | 398.5 g/mol |
| IUPAC name | 4-(4-methylphenyl)sulfonyloxybutyl 4-methylbenzenesulfonate |
| InChIKey | FSQYJJHVABILHQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCCCOS(=O)(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)