CAS 79623-37-3 appears in our catalog under these names: 3–Chloro–5–(trifluoromethyl)pyridin–2–ol, 3-Chloro-5-(trifluoromethyl)pyridin-2-ol, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g.
3-chloro-5-(trifluoromethyl)-1H-pyridin-2-one (CAS 79623-37-3) is a chemical compound with the molecular formula C6H3ClF3NO and a molecular weight of 197.54 g/mol. IUPAC name: 3-chloro-5-(trifluoromethyl)-1H-pyridin-2-one. InChIKey: AJPOOWWMZOPUCG-UHFFFAOYSA-N.
| Molecular formula | C6H3ClF3NO |
|---|---|
| Molecular weight | 197.54 g/mol |
| IUPAC name | 3-chloro-5-(trifluoromethyl)-1H-pyridin-2-one |
| InChIKey | AJPOOWWMZOPUCG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC=C1C(F)(F)F)Cl |
Computed by PubChem (NCBI)