CAS 796738-72-2 appears in our catalog under these names: 1-(2-Methyl-4-nitrophenyl)guanidine, 98%, Imatinib Impurity 59. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-methyl-4-nitrophenyl)guanidine (CAS 796738-72-2) is a chemical compound with the molecular formula C8H10N4O2 and a molecular weight of 194.19 g/mol. IUPAC name: 2-(2-methyl-4-nitrophenyl)guanidine. InChIKey: STXXMCQQEVOHHE-UHFFFAOYSA-N.
| Molecular formula | C8H10N4O2 |
|---|---|
| Molecular weight | 194.19 g/mol |
| IUPAC name | 2-(2-methyl-4-nitrophenyl)guanidine |
| InChIKey | STXXMCQQEVOHHE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)[N+](=O)[O-])N=C(N)N |
Computed by PubChem (NCBI)