Products 797038-37-0
CAS 797038-37-0 is the registry number for di-tert-butyl 2H-pyrrole-1,3(5H)-dicarboxylate, 95%. Offered by: Chemat. Available pack sizes: 1g.
Ditert-butyl 2,5-dihydropyrrole-1,3-dicarboxylate (CAS 797038-37-0) is a chemical compound with the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. IUPAC name: ditert-butyl 2,5-dihydropyrrole-1,3-dicarboxylate. InChIKey: DJTBTEYCOSMOBU-UHFFFAOYSA-N.
| Molecular formula | C14H23NO4 |
|---|---|
| Molecular weight | 269.34 g/mol |
| IUPAC name | ditert-butyl 2,5-dihydropyrrole-1,3-dicarboxylate |
| InChIKey | DJTBTEYCOSMOBU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CCN(C1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)