Products 79720-70-0
CAS 79720-70-0 appears in our catalog under these names: 3-(5-Phenyl-1h-pyrrol-2-yl)propanoic acid, 95%, 3-(5-Phenyl-1H-pyrrol-2-yl)-propionic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
3-(5-phenyl-1H-pyrrol-2-yl)propanoic acid (CAS 79720-70-0) is a chemical compound with the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. IUPAC name: 3-(5-phenyl-1H-pyrrol-2-yl)propanoic acid. InChIKey: RSKVDNXGAFVGIU-UHFFFAOYSA-N.
| Molecular formula | C13H13NO2 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | 3-(5-phenyl-1H-pyrrol-2-yl)propanoic acid |
| InChIKey | RSKVDNXGAFVGIU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(N2)CCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(5-phenyl-1H-pyrrol-2-yl)propanoic acid, 1H-Pyrrole-2-propanoic acid, 5-phenyl-, 5-Phenyl-1H-pyrrole-2-propanoic acid, 5-Phenylpyrrole-2-propionic acid, 3-(5-Phenyl-1H-pyrrol-2-yl)-propionic acid, 1H-Pyrrole-2-propanoicacid, 5-phenyl-, 3-(5-phenylpyrrol-2-yl)propanoic acid, ChemDiv2_004481, Probes1_000360, Probes2_000028