Products 79750-46-2
CAS 79750-46-2 appears in our catalog under these names: (6R,7R)-7-((R)-2-Amino-2-phenylacetamido)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylic acid, 95%, 95%, Cefalexin EP Impurity F, Cephalexin (Cefalexin) EP Impurity F, Cefalexin Impurity 6（EP Impurity F）, Delta2-Cephalexin, >95% (HPLC). Offered by: Chemat, Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: 100mg, on request, 10mg, 25mg, 50mg, 200mg, 5mg.
(6R,7R)-7-[[(2R)-2-amino-2-phenylacetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylic acid (CAS 79750-46-2) is a chemical compound with the molecular formula C16H17N3O4S and a molecular weight of 347.4 g/mol. IUPAC name: (6R,7R)-7-[[(2R)-2-amino-2-phenylacetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylic acid. InChIKey: UALOAEFJDPITFY-XOGJBXBPSA-N.
| Molecular formula | C16H17N3O4S |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | (6R,7R)-7-[[(2R)-2-amino-2-phenylacetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylic acid |
| InChIKey | UALOAEFJDPITFY-XOGJBXBPSA-N |
| SMILES | CC1=CS[C@@H]2[C@@H](C(=O)N2C1C(=O)O)NC(=O)[C@@H](C3=CC=CC=C3)N |
Computed by PubChem (NCBI)