Products 59865-11-1
CAS 59865-11-1 appears in our catalog under these names: Cephalexin Impurity 8 (Cephalexin Diketopiperazine), Cephalexin Diketopiperazine, 2-(3,6-Dioxo-5-phenylpiperazin-2-yl)-5-methyl-3,6-dihydro-2H-1,3-thiazine-4-carboxylic acid, 95%, Cefalexin Impurity 7. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-(3,6-dioxo-5-phenylpiperazin-2-yl)-5-methyl-3,6-dihydro-2H-1,3-thiazine-4-carboxylic acid (CAS 59865-11-1) is a chemical compound with the molecular formula C16H17N3O4S and a molecular weight of 347.4 g/mol. IUPAC name: 2-(3,6-dioxo-5-phenylpiperazin-2-yl)-5-methyl-3,6-dihydro-2H-1,3-thiazine-4-carboxylic acid. InChIKey: BGVLRSBBXLRVEG-UHFFFAOYSA-N.
| Molecular formula | C16H17N3O4S |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | 2-(3,6-dioxo-5-phenylpiperazin-2-yl)-5-methyl-3,6-dihydro-2H-1,3-thiazine-4-carboxylic acid |
| InChIKey | BGVLRSBBXLRVEG-UHFFFAOYSA-N |
| SMILES | CC1=C(NC(SC1)C2C(=O)NC(C(=O)N2)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)