CAS 34632-04-7 appears in our catalog under these names: L-Cephalexin, Cefalexin Impurity 9, L-Cephalexin, 97%, Cefalexin Impurity 10, L-Cephalexin, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(6R,7R)-7-[[(2S)-2-amino-2-phenylacetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS 34632-04-7) is a chemical compound with the molecular formula C16H17N3O4S and a molecular weight of 347.4 g/mol. IUPAC name: (6R,7R)-7-[[(2S)-2-amino-2-phenylacetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid. InChIKey: ZAIPMKNFIOOWCQ-FIXISWKDSA-N.
| Molecular formula | C16H17N3O4S |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | (6R,7R)-7-[[(2S)-2-amino-2-phenylacetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| InChIKey | ZAIPMKNFIOOWCQ-FIXISWKDSA-N |
| SMILES | CC1=C(N2[C@@H]([C@@H](C2=O)NC(=O)[C@H](C3=CC=CC=C3)N)SC1)C(=O)O |
Computed by PubChem (NCBI)