Products 79768-25-5
CAS 79768-25-5 is the registry number for 14-Hydroxyisocaryophyllene. Offered by: TRC. Available pack sizes: 100mg.
[(1R,4E,9S)-11,11-dimethyl-8-methylidene-4-bicyclo[7.2.0]undec-4-enyl]methanol (CAS 79768-25-5) is a chemical compound with the molecular formula C15H24O and a molecular weight of 220.35 g/mol. IUPAC name: [(1R,4E,9S)-11,11-dimethyl-8-methylidene-4-bicyclo[7.2.0]undec-4-enyl]methanol. InChIKey: MGIQTXDHQJGPEZ-BARLUBHISA-N.
| Molecular formula | C15H24O |
|---|---|
| Molecular weight | 220.35 g/mol |
| IUPAC name | [(1R,4E,9S)-11,11-dimethyl-8-methylidene-4-bicyclo[7.2.0]undec-4-enyl]methanol |
| InChIKey | MGIQTXDHQJGPEZ-BARLUBHISA-N |
| SMILES | CC1(C[C@H]2[C@H]1CC/C(=C\CCC2=C)/CO)C |
Computed by PubChem (NCBI)