Products 797806-18-9

CAS 797806-18-9 is the registry number for 3-(2-Benzyl-benzoimidazol-1-yl)-propionic acid. Offered by: Biosynth. Available pack sizes: 50mg, 100mg.

Structural formula: {0} (CAS {1})

3-(2-benzylbenzimidazol-1-yl)propanoic acid (CAS 797806-18-9) is a chemical compound with the molecular formula C17H16N2O2 and a molecular weight of 280.32 g/mol. IUPAC name: 3-(2-benzylbenzimidazol-1-yl)propanoic acid. InChIKey: OHIXXNSKBKYWEO-UHFFFAOYSA-N.

Identity
Molecular formulaC17H16N2O2
Molecular weight280.32 g/mol
IUPAC name3-(2-benzylbenzimidazol-1-yl)propanoic acid
InChIKeyOHIXXNSKBKYWEO-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CC2=NC3=CC=CC=C3N2CCC(=O)O

Computed by PubChem (NCBI)