CAS 79944-56-2 appears in our catalog under these names: 2-(2,3-Dihydrobenzo[b][1,4]dioxin-2-yl)-4,5-dihydro-1H-imidazole hydrochloride, 98%, Idazoxan Hydrochloride, >95% (HPLC), Idazoxan hydrochloride/ 99.84% (existing batch purity), Idazoxan hydrochloride, Idazoxan hydrochloride. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: on request, 100mg, 1g, 5mg, 10mg, 10mM (in 1ml dmso), 25mg, 50mg.
2-(2,3-dihydro-1,4-benzodioxin-3-yl)-4,5-dihydro-1H-imidazole;hydrochloride (CAS 79944-56-2) is a chemical compound with the molecular formula C11H13ClN2O2 and a molecular weight of 240.68 g/mol. IUPAC name: 2-(2,3-dihydro-1,4-benzodioxin-3-yl)-4,5-dihydro-1H-imidazole;hydrochloride. InChIKey: MYUBYOVCLMEAOH-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O2 |
|---|---|
| Molecular weight | 240.68 g/mol |
| IUPAC name | 2-(2,3-dihydro-1,4-benzodioxin-3-yl)-4,5-dihydro-1H-imidazole;hydrochloride |
| InChIKey | MYUBYOVCLMEAOH-UHFFFAOYSA-N |
| SMILES | C1CN=C(N1)C2COC3=CC=CC=C3O2.Cl |
Computed by PubChem (NCBI)